About 3-phenylselanylpropanoyl chloride
3-phenylselanylpropanoyl chloride (PubChem CID 14105312) has the molecular formula C9H9ClOSe
and a molecular weight of 247.58 g/mol. Its IUPAC name is 3-phenylselanylpropanoyl chloride.
Molecular Properties
| Compound Name | 3-phenylselanylpropanoyl chloride |
| PubChem CID | 14105312 |
| Molecular Formula | C9H9ClOSe |
| Molecular Weight | 247.58 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 3-phenylselanylpropanoyl chloride |
| SMILES | O=C(Cl)CC[Se]c1ccccc1 |
| InChI | InChI=1S/C9H9ClOSe/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | LNHWWYVRYYRTPC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylselanylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylselanylpropanoyl chloride?
The IUPAC name of 3-phenylselanylpropanoyl chloride (CID 14105312) is 3-phenylselanylpropanoyl chloride.
What is the SMILES notation for 3-phenylselanylpropanoyl chloride?
The canonical SMILES for 3-phenylselanylpropanoyl chloride is O=C(Cl)CC[Se]c1ccccc1.
What is the InChIKey of 3-phenylselanylpropanoyl chloride?
The InChIKey is LNHWWYVRYYRTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClOSe/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 3-phenylselanylpropanoyl chloride?
3-phenylselanylpropanoyl chloride has a molecular weight of 247.58 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylselanylpropanoyl chloride is sourced from PubChem (CID 14105312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).