3-phenylselanylpropanoyl chloride

C9H9ClOSe — CID 14105312

IUPAC3-phenylselanylpropanoyl chloride
SMILESO=C(Cl)CC[Se]c1ccccc1
InChIInChI=1S/C9H9ClOSe/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2
InChIKeyLNHWWYVRYYRTPC-UHFFFAOYSA-N
MW247.58 g/mol
LogP1.59
Rot. Bonds4

About 3-phenylselanylpropanoyl chloride

3-phenylselanylpropanoyl chloride (PubChem CID 14105312) has the molecular formula C9H9ClOSe and a molecular weight of 247.58 g/mol. Its IUPAC name is 3-phenylselanylpropanoyl chloride.

Molecular Properties

Compound Name3-phenylselanylpropanoyl chloride
PubChem CID14105312
Molecular FormulaC9H9ClOSe
Molecular Weight247.58 g/mol
Exact Mass247.95
IUPAC Name3-phenylselanylpropanoyl chloride
SMILESO=C(Cl)CC[Se]c1ccccc1
InChIInChI=1S/C9H9ClOSe/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2
InChIKeyLNHWWYVRYYRTPC-UHFFFAOYSA-N
XLogP1.59
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.58
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 3-phenylselanylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenylselanylpropanoyl chloride?
The IUPAC name of 3-phenylselanylpropanoyl chloride (CID 14105312) is 3-phenylselanylpropanoyl chloride.
What is the SMILES notation for 3-phenylselanylpropanoyl chloride?
The canonical SMILES for 3-phenylselanylpropanoyl chloride is O=C(Cl)CC[Se]c1ccccc1.
What is the InChIKey of 3-phenylselanylpropanoyl chloride?
The InChIKey is LNHWWYVRYYRTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClOSe/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 3-phenylselanylpropanoyl chloride?
3-phenylselanylpropanoyl chloride has a molecular weight of 247.58 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylselanylpropanoyl chloride is sourced from PubChem (CID 14105312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).