About 3,3-bis(1,3-dioxan-2-yloxy)propanal
3,3-bis(1,3-dioxan-2-yloxy)propanal (PubChem CID 141053260) has the molecular formula C11H18O7
and a molecular weight of 262.26 g/mol. Its IUPAC name is 3,3-bis(1,3-dioxan-2-yloxy)propanal.
Molecular Properties
| Compound Name | 3,3-bis(1,3-dioxan-2-yloxy)propanal |
| PubChem CID | 141053260 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3,3-bis(1,3-dioxan-2-yloxy)propanal |
| SMILES | O=CCC(OC1OCCCO1)OC1OCCCO1 |
| InChI | InChI=1S/C11H18O7/c12-4-3-9(17-10-13-5-1-6-14-10)18-11-15-7-2-8-16-11/h4,9-11H,1-3,5-8H2 |
| InChIKey | AYCQQVNZASSGIP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(1,3-dioxan-2-yloxy)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(1,3-dioxan-2-yloxy)propanal?
The IUPAC name of 3,3-bis(1,3-dioxan-2-yloxy)propanal (CID 141053260) is 3,3-bis(1,3-dioxan-2-yloxy)propanal.
What is the SMILES notation for 3,3-bis(1,3-dioxan-2-yloxy)propanal?
The canonical SMILES for 3,3-bis(1,3-dioxan-2-yloxy)propanal is O=CCC(OC1OCCCO1)OC1OCCCO1.
What is the InChIKey of 3,3-bis(1,3-dioxan-2-yloxy)propanal?
The InChIKey is AYCQQVNZASSGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O7/c12-4-3-9(17-10-13-5-1-6-14-10)18-11-15-7-2-8-16-11/h4,9-11H,1-3,5-8H2.
What are the key properties of 3,3-bis(1,3-dioxan-2-yloxy)propanal?
3,3-bis(1,3-dioxan-2-yloxy)propanal has a molecular weight of 262.26 g/mol, XLogP of 0.38, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(1,3-dioxan-2-yloxy)propanal is sourced from PubChem (CID 141053260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).