C16H28FNO3 — CID 141053667
tert-butyl (2S,4S)-4-fluoro-2-(hex-5-enoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 141053667) has the molecular formula C16H28FNO3 and a molecular weight of 301.40 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-(hex-5-enoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-(hex-5-enoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141053667 |
| Molecular Formula | C16H28FNO3 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-(hex-5-enoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCCCCOC[C@@H]1C[C@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28FNO3/c1-5-6-7-8-9-20-12-14-10-13(17)11-18(14)15(19)21-16(2,3)4/h5,13-14H,1,6-12H2,2-4H3/t13-,14-/m0/s1 |
| InChIKey | OKWKUJKBCGXFNM-KBPBESRZSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|