About 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine
6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine (PubChem CID 141054133) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 141054133 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C(C(C)C)=CC=CC1C |
| InChI | InChI=1S/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-8,11H,1-3H3/b11-10+ |
| InChIKey | VFJLIZGWMGWQQC-ZHACJKMWSA-N |
| XLogP | 2.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine?
The IUPAC name of 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine (CID 141054133) is 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine is [H]/N=C1/C(C(C)C)=CC=CC1C.
What is the InChIKey of 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine?
The InChIKey is VFJLIZGWMGWQQC-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-8,11H,1-3H3/b11-10+.
What are the key properties of 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine?
6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine has a molecular weight of 149.24 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-ylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 141054133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).