C28H56O5 — CID 141054594
17-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6,10,12,16-tetramethylheptadecane-1,3,6-triol (PubChem CID 141054594) has the molecular formula C28H56O5 and a molecular weight of 472.75 g/mol. Its IUPAC name is 17-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6,10,12,16-tetramethylheptadecane-1,3,6-triol.
| Compound Name | 17-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6,10,12,16-tetramethylheptadecane-1,3,6-triol |
|---|---|
| PubChem CID | 141054594 |
| Molecular Formula | C28H56O5 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.41 |
| IUPAC Name | 17-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6,10,12,16-tetramethylheptadecane-1,3,6-triol |
| SMILES | CCC(O)C(C)C1OC1CC(C)CCCC(C)CC(C)CCCC(C)(O)CCC(O)CCO |
| InChI | InChI=1S/C28H56O5/c1-7-25(31)23(5)27-26(33-27)19-22(4)11-8-10-20(2)18-21(3)12-9-15-28(6,32)16-13-24(30)14-17-29/h20-27,29-32H,7-19H2,1-6H3 |
| InChIKey | BAYFCABBDYDJQM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|