About 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole
1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole (PubChem CID 141054833) has the molecular formula C15H14Cl2N4
and a molecular weight of 321.21 g/mol. Its IUPAC name is 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole |
| PubChem CID | 141054833 |
| Molecular Formula | C15H14Cl2N4 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole |
| SMILES | Cc1cnc(C)n1Cc1cn(-c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C15H14Cl2N4/c1-10-6-18-11(2)21(10)8-12-7-20(9-19-12)13-3-4-14(16)15(17)5-13/h3-7,9H,8H2,1-2H3 |
| InChIKey | XBRMJEAUOOFTQT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole?
The IUPAC name of 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole (CID 141054833) is 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole.
What is the SMILES notation for 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole?
The canonical SMILES for 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole is Cc1cnc(C)n1Cc1cn(-c2ccc(Cl)c(Cl)c2)cn1.
What is the InChIKey of 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole?
The InChIKey is XBRMJEAUOOFTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N4/c1-10-6-18-11(2)21(10)8-12-7-20(9-19-12)13-3-4-14(16)15(17)5-13/h3-7,9H,8H2,1-2H3.
What are the key properties of 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole?
1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole has a molecular weight of 321.21 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(3,4-dichlorophenyl)imidazol-4-yl]methyl]-2,5-dimethylimidazole is sourced from PubChem (CID 141054833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).