C25H17N3OS — CID 141055418
4-(furan-2-yl)-2-pyridin-2-yl-5-(1H-pyrrol-2-yl)-3-thiophen-2-yl-1H-indole (PubChem CID 141055418) has the molecular formula C25H17N3OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-(furan-2-yl)-2-pyridin-2-yl-5-(1H-pyrrol-2-yl)-3-thiophen-2-yl-1H-indole.
| Compound Name | 4-(furan-2-yl)-2-pyridin-2-yl-5-(1H-pyrrol-2-yl)-3-thiophen-2-yl-1H-indole |
|---|---|
| PubChem CID | 141055418 |
| Molecular Formula | C25H17N3OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-(furan-2-yl)-2-pyridin-2-yl-5-(1H-pyrrol-2-yl)-3-thiophen-2-yl-1H-indole |
| SMILES | c1ccc(-c2[nH]c3ccc(-c4ccc[nH]4)c(-c4ccco4)c3c2-c2cccs2)nc1 |
| InChI | InChI=1S/C25H17N3OS/c1-2-12-27-19(6-1)25-24(21-9-5-15-30-21)23-18(28-25)11-10-16(17-7-3-13-26-17)22(23)20-8-4-14-29-20/h1-15,26,28H |
| InChIKey | CMKCHFPXVFIJDY-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |