About 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one
1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one (PubChem CID 141055442) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one.
Molecular Properties
| Compound Name | 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one |
| PubChem CID | 141055442 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one |
| SMILES | CC1C(=O)N=c2ccc3c(c21)C=CCN=3 |
| InChI | InChI=1S/C12H10N2O/c1-7-11-8-3-2-6-13-9(8)4-5-10(11)14-12(7)15/h2-5,7H,6H2,1H3 |
| InChIKey | BAZCGWCIVKHCTR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one?
The IUPAC name of 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one (CID 141055442) is 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one.
What is the SMILES notation for 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one?
The canonical SMILES for 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one is CC1C(=O)N=c2ccc3c(c21)C=CCN=3.
What is the InChIKey of 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one?
The InChIKey is BAZCGWCIVKHCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-7-11-8-3-2-6-13-9(8)4-5-10(11)14-12(7)15/h2-5,7H,6H2,1H3.
What are the key properties of 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one?
1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one has a molecular weight of 198.22 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,7-dihydropyrrolo[3,2-f]quinolin-2-one is sourced from PubChem (CID 141055442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).