About 2-(2-fluoroethyl)-2H-1,4-benzoxazine
2-(2-fluoroethyl)-2H-1,4-benzoxazine (PubChem CID 141055461) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2-(2-fluoroethyl)-2H-1,4-benzoxazine |
| PubChem CID | 141055461 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(2-fluoroethyl)-2H-1,4-benzoxazine |
| SMILES | FCCC1C=Nc2ccccc2O1 |
| InChI | InChI=1S/C10H10FNO/c11-6-5-8-7-12-9-3-1-2-4-10(9)13-8/h1-4,7-8H,5-6H2 |
| InChIKey | REAQHNOSPYDTCJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluoroethyl)-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethyl)-2H-1,4-benzoxazine?
The IUPAC name of 2-(2-fluoroethyl)-2H-1,4-benzoxazine (CID 141055461) is 2-(2-fluoroethyl)-2H-1,4-benzoxazine.
What is the SMILES notation for 2-(2-fluoroethyl)-2H-1,4-benzoxazine?
The canonical SMILES for 2-(2-fluoroethyl)-2H-1,4-benzoxazine is FCCC1C=Nc2ccccc2O1.
What is the InChIKey of 2-(2-fluoroethyl)-2H-1,4-benzoxazine?
The InChIKey is REAQHNOSPYDTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c11-6-5-8-7-12-9-3-1-2-4-10(9)13-8/h1-4,7-8H,5-6H2.
What are the key properties of 2-(2-fluoroethyl)-2H-1,4-benzoxazine?
2-(2-fluoroethyl)-2H-1,4-benzoxazine has a molecular weight of 179.19 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethyl)-2H-1,4-benzoxazine is sourced from PubChem (CID 141055461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).