C15H24O4 — CID 141055839
2,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 141055839) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 2,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 141055839 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | O=C1CCCCCCC2OC2OCCC(=O)CCC1 |
| InChI | InChI=1S/C15H24O4/c16-12-6-3-1-2-4-9-14-15(19-14)18-11-10-13(17)8-5-7-12/h14-15H,1-11H2 |
| InChIKey | KZVLRFHLYWTLBG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|