C22H30 — CID 141056447
6-(cyclohexen-1-yl)-1,6-di(cyclopenten-1-yl)cyclohexene (PubChem CID 141056447) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-1,6-di(cyclopenten-1-yl)cyclohexene.
| Compound Name | 6-(cyclohexen-1-yl)-1,6-di(cyclopenten-1-yl)cyclohexene |
|---|---|
| PubChem CID | 141056447 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 6-(cyclohexen-1-yl)-1,6-di(cyclopenten-1-yl)cyclohexene |
| SMILES | C1=C(C2=CCCCC2(C2=CCCC2)C2=CCCCC2)CCC1 |
| InChI | InChI=1S/C22H30/c1-2-12-19(13-3-1)22(20-14-6-7-15-20)17-9-8-16-21(22)18-10-4-5-11-18/h10,12,14,16H,1-9,11,13,15,17H2 |
| InChIKey | PQQPRTGGEGYECW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|