C8H12Cl2N2O — CID 141057347
4a,5,8,8a-tetrahydro-2H-phthalazin-1-one;dihydrochloride (PubChem CID 141057347) has the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. Its IUPAC name is 4a,5,8,8a-tetrahydro-2H-phthalazin-1-one;dihydrochloride.
| Compound Name | 4a,5,8,8a-tetrahydro-2H-phthalazin-1-one;dihydrochloride |
|---|---|
| PubChem CID | 141057347 |
| Molecular Formula | C8H12Cl2N2O |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 4a,5,8,8a-tetrahydro-2H-phthalazin-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NN=CC2CC=CCC12 |
| InChI | InChI=1S/C8H10N2O.2ClH/c11-8-7-4-2-1-3-6(7)5-9-10-8;;/h1-2,5-7H,3-4H2,(H,10,11);2*1H |
| InChIKey | JPZSVGBHFQFOAD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|