About N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide
N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide (PubChem CID 141057792) has the molecular formula C21H24N2O3S2
and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide |
| PubChem CID | 141057792 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide |
| SMILES | Cc1cc(OCc2ccccc2)c(N(C(C)C)S(=O)(=O)c2nccs2)cc1C |
| InChI | InChI=1S/C21H24N2O3S2/c1-15(2)23(28(24,25)21-22-10-11-27-21)19-12-16(3)17(4)13-20(19)26-14-18-8-6-5-7-9-18/h5-13,15H,14H2,1-4H3 |
| InChIKey | CEBVLMXEDNBFSK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide?
The IUPAC name of N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide (CID 141057792) is N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide?
The canonical SMILES for N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide is Cc1cc(OCc2ccccc2)c(N(C(C)C)S(=O)(=O)c2nccs2)cc1C.
What is the InChIKey of N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide?
The InChIKey is CEBVLMXEDNBFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3S2/c1-15(2)23(28(24,25)21-22-10-11-27-21)19-12-16(3)17(4)13-20(19)26-14-18-8-6-5-7-9-18/h5-13,15H,14H2,1-4H3.
What are the key properties of N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide?
N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide has a molecular weight of 416.57 g/mol, XLogP of 4.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-2-phenylmethoxyphenyl)-N-propan-2-yl-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 141057792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).