About 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine
4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine (PubChem CID 141057883) has the molecular formula C19H27N3O3S
and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine.
Molecular Properties
| Compound Name | 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine |
| PubChem CID | 141057883 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine |
| SMILES | Cc1ccc(COC2CCN(S(=O)(=O)C[C@]3(C)C=NC=N3)CC2)cc1C |
| InChI | InChI=1S/C19H27N3O3S/c1-15-4-5-17(10-16(15)2)11-25-18-6-8-22(9-7-18)26(23,24)13-19(3)12-20-14-21-19/h4-5,10,12,14,18H,6-9,11,13H2,1-3H3/t19-/m0/s1 |
| InChIKey | VBDIDQPYIFSRSK-IBGZPJMESA-N |
| XLogP | 2.49 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine?
The IUPAC name of 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine (CID 141057883) is 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine.
What is the SMILES notation for 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine?
The canonical SMILES for 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine is Cc1ccc(COC2CCN(S(=O)(=O)C[C@]3(C)C=NC=N3)CC2)cc1C.
What is the InChIKey of 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine?
The InChIKey is VBDIDQPYIFSRSK-IBGZPJMESA-N. The full InChI is InChI=1S/C19H27N3O3S/c1-15-4-5-17(10-16(15)2)11-25-18-6-8-22(9-7-18)26(23,24)13-19(3)12-20-14-21-19/h4-5,10,12,14,18H,6-9,11,13H2,1-3H3/t19-/m0/s1.
What are the key properties of 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine?
4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine has a molecular weight of 377.51 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylphenyl)methoxy]-1-[[(4S)-4-methylimidazol-4-yl]methylsulfonyl]piperidine is sourced from PubChem (CID 141057883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).