C21H24N2O4 — CID 141058042
3-[1-(2-hydroxy-3-phenoxypropyl)piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 141058042) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-phenoxypropyl)piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-(2-hydroxy-3-phenoxypropyl)piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 141058042 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[1-(2-hydroxy-3-phenoxypropyl)piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1C1CCN(CC(O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O4/c24-17(15-26-18-6-2-1-3-7-18)14-22-12-10-16(11-13-22)23-19-8-4-5-9-20(19)27-21(23)25/h1-9,16-17,24H,10-15H2 |
| InChIKey | MYWQUDSMRDHDCG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |