About 2-(fluoromethyl)-1,3-oxazolidin-5-one
2-(fluoromethyl)-1,3-oxazolidin-5-one (PubChem CID 141058259) has the molecular formula C4H6FNO2
and a molecular weight of 119.09 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-1,3-oxazolidin-5-one |
| PubChem CID | 141058259 |
| Molecular Formula | C4H6FNO2 |
| Molecular Weight | 119.09 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 2-(fluoromethyl)-1,3-oxazolidin-5-one |
| SMILES | O=C1CNC(CF)O1 |
| InChI | InChI=1S/C4H6FNO2/c5-1-3-6-2-4(7)8-3/h3,6H,1-2H2 |
| InChIKey | MMNFRUAVOMGXPA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.09 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(fluoromethyl)-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-1,3-oxazolidin-5-one?
The IUPAC name of 2-(fluoromethyl)-1,3-oxazolidin-5-one (CID 141058259) is 2-(fluoromethyl)-1,3-oxazolidin-5-one.
What is the SMILES notation for 2-(fluoromethyl)-1,3-oxazolidin-5-one?
The canonical SMILES for 2-(fluoromethyl)-1,3-oxazolidin-5-one is O=C1CNC(CF)O1.
What is the InChIKey of 2-(fluoromethyl)-1,3-oxazolidin-5-one?
The InChIKey is MMNFRUAVOMGXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FNO2/c5-1-3-6-2-4(7)8-3/h3,6H,1-2H2.
What are the key properties of 2-(fluoromethyl)-1,3-oxazolidin-5-one?
2-(fluoromethyl)-1,3-oxazolidin-5-one has a molecular weight of 119.09 g/mol, XLogP of -0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-1,3-oxazolidin-5-one is sourced from PubChem (CID 141058259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).