C28H30N4 — CID 141058438
(1S,2R,5Z,10Z,14Z,19Z)-3-ethenyl-8-ethyl-2,7,12,18-tetramethyl-1,2,21,23-tetrahydroporphyrin (PubChem CID 141058438) has the molecular formula C28H30N4 and a molecular weight of 422.58 g/mol. Its IUPAC name is (1S,2R,5Z,10Z,14Z,19Z)-3-ethenyl-8-ethyl-2,7,12,18-tetramethyl-1,2,21,23-tetrahydroporphyrin.
| Compound Name | (1S,2R,5Z,10Z,14Z,19Z)-3-ethenyl-8-ethyl-2,7,12,18-tetramethyl-1,2,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 141058438 |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (1S,2R,5Z,10Z,14Z,19Z)-3-ethenyl-8-ethyl-2,7,12,18-tetramethyl-1,2,21,23-tetrahydroporphyrin |
| SMILES | C=CC1=C2/C=C3\N=C(/C=c4\[nH]/c(cc4C)=C\C4=N/C(=C\[C@@H](N2)[C@@H]1C)C(C)=C4)C(CC)=C3C |
| InChI | InChI=1S/C28H30N4/c1-7-21-18(6)26-14-28-22(8-2)17(5)25(31-28)12-23-15(3)9-19(29-23)11-20-10-16(4)24(30-20)13-27(21)32-26/h8-14,17,25,30-31H,2,7H2,1,3-6H3/b20-11-,23-12-,24-13-,26-14-/t17-,25-/m1/s1 |
| InChIKey | LAIVMMNKRJKZAG-DJQRPQESSA-N |
| XLogP | 4.30 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |