About 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol
2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol (PubChem CID 141059066) has the molecular formula C25H44OS2
and a molecular weight of 424.76 g/mol. Its IUPAC name is 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol |
| PubChem CID | 141059066 |
| Molecular Formula | C25H44OS2 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol |
| SMILES | CCCCCCCCSC=C1C=C(C)C(O)C(=CSCCCCCCCC)C1 |
| InChI | InChI=1S/C25H44OS2/c1-4-6-8-10-12-14-16-27-20-23-18-22(3)25(26)24(19-23)21-28-17-15-13-11-9-7-5-2/h18,20-21,25-26H,4-17,19H2,1-3H3 |
| InChIKey | HHRAWPICZKGGFQ-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol?
The IUPAC name of 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol (CID 141059066) is 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol.
What is the SMILES notation for 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol?
The canonical SMILES for 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol is CCCCCCCCSC=C1C=C(C)C(O)C(=CSCCCCCCCC)C1.
What is the InChIKey of 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol?
The InChIKey is HHRAWPICZKGGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44OS2/c1-4-6-8-10-12-14-16-27-20-23-18-22(3)25(26)24(19-23)21-28-17-15-13-11-9-7-5-2/h18,20-21,25-26H,4-17,19H2,1-3H3.
What are the key properties of 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol?
2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol has a molecular weight of 424.76 g/mol, XLogP of 8.65, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-bis(octylsulfanylmethylidene)cyclohex-2-en-1-ol is sourced from PubChem (CID 141059066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).