About tris[2-(4-fluorophenyl)propyl]alumane;hydrate
tris[2-(4-fluorophenyl)propyl]alumane;hydrate (PubChem CID 141059383) has the molecular formula C27H32AlF3O
and a molecular weight of 456.53 g/mol. Its IUPAC name is tris[2-(4-fluorophenyl)propyl]alumane;hydrate.
Molecular Properties
| Compound Name | tris[2-(4-fluorophenyl)propyl]alumane;hydrate |
| PubChem CID | 141059383 |
| Molecular Formula | C27H32AlF3O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | tris[2-(4-fluorophenyl)propyl]alumane;hydrate |
| SMILES | CC(C[Al](CC(C)c1ccc(F)cc1)CC(C)c1ccc(F)cc1)c1ccc(F)cc1.O |
| InChI | InChI=1S/3C9H10F.Al.H2O/c3*1-7(2)8-3-5-9(10)6-4-8;;/h3*3-7H,1H2,2H3;;1H2 |
| InChIKey | HTXMXUVPLIBKGS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tris[2-(4-fluorophenyl)propyl]alumane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[2-(4-fluorophenyl)propyl]alumane;hydrate?
The IUPAC name of tris[2-(4-fluorophenyl)propyl]alumane;hydrate (CID 141059383) is tris[2-(4-fluorophenyl)propyl]alumane;hydrate.
What is the SMILES notation for tris[2-(4-fluorophenyl)propyl]alumane;hydrate?
The canonical SMILES for tris[2-(4-fluorophenyl)propyl]alumane;hydrate is CC(C[Al](CC(C)c1ccc(F)cc1)CC(C)c1ccc(F)cc1)c1ccc(F)cc1.O.
What is the InChIKey of tris[2-(4-fluorophenyl)propyl]alumane;hydrate?
The InChIKey is HTXMXUVPLIBKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/3C9H10F.Al.H2O/c3*1-7(2)8-3-5-9(10)6-4-8;;/h3*3-7H,1H2,2H3;;1H2.
What are the key properties of tris[2-(4-fluorophenyl)propyl]alumane;hydrate?
tris[2-(4-fluorophenyl)propyl]alumane;hydrate has a molecular weight of 456.53 g/mol, XLogP of 7.48, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris[2-(4-fluorophenyl)propyl]alumane;hydrate is sourced from PubChem (CID 141059383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).