C9H13N3 — CID 141059813
3-prop-2-enyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 141059813) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-prop-2-enyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-prop-2-enyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 141059813 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-prop-2-enyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | C=CCc1cnn2c1NCCC2 |
| InChI | InChI=1S/C9H13N3/c1-2-4-8-7-11-12-6-3-5-10-9(8)12/h2,7,10H,1,3-6H2 |
| InChIKey | HXNGOAVURNCZCK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|