cyclohexane-1,4-dicarboxylic acid

C8H12O4 — CID 14106

IUPACcyclohexane-1,4-dicarboxylic acid
SMILESO=C(O)C1CCC(C(=O)O)CC1
InChIInChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)
InChIKeyPXGZQGDTEZPERC-UHFFFAOYSA-N
MW172.18 g/mol
LogP0.96
Rot. Bonds2

About cyclohexane-1,4-dicarboxylic acid

cyclohexane-1,4-dicarboxylic acid (PubChem CID 14106) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is cyclohexane-1,4-dicarboxylic acid.

Molecular Properties

Compound Namecyclohexane-1,4-dicarboxylic acid
PubChem CID14106
Molecular FormulaC8H12O4
Molecular Weight172.18 g/mol
Exact Mass172.07
IUPAC Namecyclohexane-1,4-dicarboxylic acid
SMILESO=C(O)C1CCC(C(=O)O)CC1
InChIInChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)
InChIKeyPXGZQGDTEZPERC-UHFFFAOYSA-N
XLogP0.96
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.18
LogP ≤ 50.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cyclohexane-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexane-1,4-dicarboxylic acid?
The IUPAC name of cyclohexane-1,4-dicarboxylic acid (CID 14106) is cyclohexane-1,4-dicarboxylic acid.
What is the SMILES notation for cyclohexane-1,4-dicarboxylic acid?
The canonical SMILES for cyclohexane-1,4-dicarboxylic acid is O=C(O)C1CCC(C(=O)O)CC1.
What is the InChIKey of cyclohexane-1,4-dicarboxylic acid?
The InChIKey is PXGZQGDTEZPERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12).
What are the key properties of cyclohexane-1,4-dicarboxylic acid?
cyclohexane-1,4-dicarboxylic acid has a molecular weight of 172.18 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-dicarboxylic acid is sourced from PubChem (CID 14106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).