C21H30Cl2N2O — CID 141060166
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl)-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 141060166) has the molecular formula C21H30Cl2N2O and a molecular weight of 397.39 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl)-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl)-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 141060166 |
| Molecular Formula | C21H30Cl2N2O |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl)-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(C(=O)Cc1ccc(Cl)c(Cl)c1)C1NCCC2CCCCC21 |
| InChI | InChI=1S/C21H30Cl2N2O/c1-14(2)13-25(20(26)12-15-7-8-18(22)19(23)11-15)21-17-6-4-3-5-16(17)9-10-24-21/h7-8,11,14,16-17,21,24H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | GIJRVTQVXHIYNT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |