About [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate
[1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate (PubChem CID 141060200) has the molecular formula C16H18Cl2O5
and a molecular weight of 361.22 g/mol. Its IUPAC name is [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate.
Molecular Properties
| Compound Name | [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate |
| PubChem CID | 141060200 |
| Molecular Formula | C16H18Cl2O5 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate |
| SMILES | CC(=O)CC(OC(=O)c1c(Cl)cccc1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H18Cl2O5/c1-9(19)8-12(14(20)23-16(2,3)4)22-15(21)13-10(17)6-5-7-11(13)18/h5-7,12H,8H2,1-4H3 |
| InChIKey | WONSYFZQQTYYJH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate?
The IUPAC name of [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate (CID 141060200) is [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate.
What is the SMILES notation for [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate?
The canonical SMILES for [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate is CC(=O)CC(OC(=O)c1c(Cl)cccc1Cl)C(=O)OC(C)(C)C.
What is the InChIKey of [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate?
The InChIKey is WONSYFZQQTYYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2O5/c1-9(19)8-12(14(20)23-16(2,3)4)22-15(21)13-10(17)6-5-7-11(13)18/h5-7,12H,8H2,1-4H3.
What are the key properties of [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate?
[1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate has a molecular weight of 361.22 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-methylpropan-2-yl)oxy]-1,4-dioxopentan-2-yl] 2,6-dichlorobenzoate is sourced from PubChem (CID 141060200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).