About 3-(2-phenylphenyl)-1,2-benzoselenazole
3-(2-phenylphenyl)-1,2-benzoselenazole (PubChem CID 141060587) has the molecular formula C19H13NSe
and a molecular weight of 334.28 g/mol. Its IUPAC name is 3-(2-phenylphenyl)-1,2-benzoselenazole.
Molecular Properties
| Compound Name | 3-(2-phenylphenyl)-1,2-benzoselenazole |
| PubChem CID | 141060587 |
| Molecular Formula | C19H13NSe |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-(2-phenylphenyl)-1,2-benzoselenazole |
| SMILES | c1ccc(-c2ccccc2-c2n[se]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H13NSe/c1-2-8-14(9-3-1)15-10-4-5-11-16(15)19-17-12-6-7-13-18(17)21-20-19/h1-13H |
| InChIKey | BJAUILMMMBMJHY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenylphenyl)-1,2-benzoselenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylphenyl)-1,2-benzoselenazole?
The IUPAC name of 3-(2-phenylphenyl)-1,2-benzoselenazole (CID 141060587) is 3-(2-phenylphenyl)-1,2-benzoselenazole.
What is the SMILES notation for 3-(2-phenylphenyl)-1,2-benzoselenazole?
The canonical SMILES for 3-(2-phenylphenyl)-1,2-benzoselenazole is c1ccc(-c2ccccc2-c2n[se]c3ccccc23)cc1.
What is the InChIKey of 3-(2-phenylphenyl)-1,2-benzoselenazole?
The InChIKey is BJAUILMMMBMJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NSe/c1-2-8-14(9-3-1)15-10-4-5-11-16(15)19-17-12-6-7-13-18(17)21-20-19/h1-13H.
What are the key properties of 3-(2-phenylphenyl)-1,2-benzoselenazole?
3-(2-phenylphenyl)-1,2-benzoselenazole has a molecular weight of 334.28 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylphenyl)-1,2-benzoselenazole is sourced from PubChem (CID 141060587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).