C11H7F5N2O2 — CID 141061438
2-(1,1,2,2,2-pentafluoroethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-e]benzimidazole (PubChem CID 141061438) has the molecular formula C11H7F5N2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-e]benzimidazole.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-e]benzimidazole |
|---|---|
| PubChem CID | 141061438 |
| Molecular Formula | C11H7F5N2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-e]benzimidazole |
| SMILES | FC(F)(F)C(F)(F)c1nc2c3c(ccc2[nH]1)OCCO3 |
| InChI | InChI=1S/C11H7F5N2O2/c12-10(13,11(14,15)16)9-17-5-1-2-6-8(7(5)18-9)20-4-3-19-6/h1-2H,3-4H2,(H,17,18) |
| InChIKey | LUPQVVZAVYJVNV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|