About 5-cyanohexanoyl chloride
5-cyanohexanoyl chloride (PubChem CID 141062136) has the molecular formula C7H10ClNO
and a molecular weight of 159.62 g/mol. Its IUPAC name is 5-cyanohexanoyl chloride.
Molecular Properties
| Compound Name | 5-cyanohexanoyl chloride |
| PubChem CID | 141062136 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 5-cyanohexanoyl chloride |
| SMILES | CC(C#N)CCCC(=O)Cl |
| InChI | InChI=1S/C7H10ClNO/c1-6(5-9)3-2-4-7(8)10/h6H,2-4H2,1H3 |
| InChIKey | YZTQMMPQMHYOHZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-cyanohexanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyanohexanoyl chloride?
The IUPAC name of 5-cyanohexanoyl chloride (CID 141062136) is 5-cyanohexanoyl chloride.
What is the SMILES notation for 5-cyanohexanoyl chloride?
The canonical SMILES for 5-cyanohexanoyl chloride is CC(C#N)CCCC(=O)Cl.
What is the InChIKey of 5-cyanohexanoyl chloride?
The InChIKey is YZTQMMPQMHYOHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNO/c1-6(5-9)3-2-4-7(8)10/h6H,2-4H2,1H3.
What are the key properties of 5-cyanohexanoyl chloride?
5-cyanohexanoyl chloride has a molecular weight of 159.62 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyanohexanoyl chloride is sourced from PubChem (CID 141062136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).