About 7-cyanooctanoyl chloride
7-cyanooctanoyl chloride (PubChem CID 141062137) has the molecular formula C9H14ClNO
and a molecular weight of 187.67 g/mol. Its IUPAC name is 7-cyanooctanoyl chloride.
Molecular Properties
| Compound Name | 7-cyanooctanoyl chloride |
| PubChem CID | 141062137 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 7-cyanooctanoyl chloride |
| SMILES | CC(C#N)CCCCCC(=O)Cl |
| InChI | InChI=1S/C9H14ClNO/c1-8(7-11)5-3-2-4-6-9(10)12/h8H,2-6H2,1H3 |
| InChIKey | CIHQPSOWUYUQLC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-cyanooctanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyanooctanoyl chloride?
The IUPAC name of 7-cyanooctanoyl chloride (CID 141062137) is 7-cyanooctanoyl chloride.
What is the SMILES notation for 7-cyanooctanoyl chloride?
The canonical SMILES for 7-cyanooctanoyl chloride is CC(C#N)CCCCCC(=O)Cl.
What is the InChIKey of 7-cyanooctanoyl chloride?
The InChIKey is CIHQPSOWUYUQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClNO/c1-8(7-11)5-3-2-4-6-9(10)12/h8H,2-6H2,1H3.
What are the key properties of 7-cyanooctanoyl chloride?
7-cyanooctanoyl chloride has a molecular weight of 187.67 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyanooctanoyl chloride is sourced from PubChem (CID 141062137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).