C17H21NO6 — CID 14106217
(3S,4R)-3,4-dihydroxy-7,8-dimethoxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one (PubChem CID 14106217) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3S,4R)-3,4-dihydroxy-7,8-dimethoxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one.
| Compound Name | (3S,4R)-3,4-dihydroxy-7,8-dimethoxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 14106217 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (3S,4R)-3,4-dihydroxy-7,8-dimethoxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one |
| SMILES | COc1ccc2c3c(c(=O)n(C)c2c1OC)[C@@H](O)[C@H](O)C(C)(C)O3 |
| InChI | InChI=1S/C17H21NO6/c1-17(2)15(20)12(19)10-13(24-17)8-6-7-9(22-4)14(23-5)11(8)18(3)16(10)21/h6-7,12,15,19-20H,1-5H3/t12-,15+/m1/s1 |
| InChIKey | KXHMBKASJFMDCK-DOMZBBRYSA-N |
| XLogP | 1.12 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |