About copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane
copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane (PubChem CID 141062183) has the molecular formula C8H17CuO2PS2
and a molecular weight of 303.88 g/mol. Its IUPAC name is copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| PubChem CID | 141062183 |
| Molecular Formula | C8H17CuO2PS2 |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCSP([O-])([O-])=S.[Cu+2] |
| InChI | InChI=1S/C8H19O2PS2.Cu/c1-2-3-4-5-6-7-8-13-11(9,10)12;/h2-8H2,1H3,(H2,9,10,12);/q;+2/p-2 |
| InChIKey | MXQNVUSPQIDYMJ-UHFFFAOYSA-L |
| XLogP | 2.02 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The IUPAC name of copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane (CID 141062183) is copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane.
What is the SMILES notation for copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The canonical SMILES for copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane is CCCCCCCCSP([O-])([O-])=S.[Cu+2].
What is the InChIKey of copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The InChIKey is MXQNVUSPQIDYMJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H19O2PS2.Cu/c1-2-3-4-5-6-7-8-13-11(9,10)12;/h2-8H2,1H3,(H2,9,10,12);/q;+2/p-2.
What are the key properties of copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane?
copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane has a molecular weight of 303.88 g/mol, XLogP of 2.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper octylsulfanyl-dioxido-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 141062183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).