C8H15ClO2 — CID 141062332
2-chloro-1,1-bis(methoxymethyl)cyclobutane (PubChem CID 141062332) has the molecular formula C8H15ClO2 and a molecular weight of 178.66 g/mol. Its IUPAC name is 2-chloro-1,1-bis(methoxymethyl)cyclobutane.
| Compound Name | 2-chloro-1,1-bis(methoxymethyl)cyclobutane |
|---|---|
| PubChem CID | 141062332 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-chloro-1,1-bis(methoxymethyl)cyclobutane |
| SMILES | COCC1(COC)CCC1Cl |
| InChI | InChI=1S/C8H15ClO2/c1-10-5-8(6-11-2)4-3-7(8)9/h7H,3-6H2,1-2H3 |
| InChIKey | LOYYXQBBMPZHOF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|