C15H17F7N2O — CID 141062732
3-(1,1,2,2-tetrafluoroethoxy)-N-[[6-(trifluoromethyl)-2-pyridinyl]methyl]cyclohexan-1-amine (PubChem CID 141062732) has the molecular formula C15H17F7N2O and a molecular weight of 374.30 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethoxy)-N-[[6-(trifluoromethyl)-2-pyridinyl]methyl]cyclohexan-1-amine.
| Compound Name | 3-(1,1,2,2-tetrafluoroethoxy)-N-[[6-(trifluoromethyl)-2-pyridinyl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 141062732 |
| Molecular Formula | C15H17F7N2O |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethoxy)-N-[[6-(trifluoromethyl)-2-pyridinyl]methyl]cyclohexan-1-amine |
| SMILES | FC(F)C(F)(F)OC1CCCC(NCc2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C15H17F7N2O/c16-13(17)15(21,22)25-11-5-1-3-9(7-11)23-8-10-4-2-6-12(24-10)14(18,19)20/h2,4,6,9,11,13,23H,1,3,5,7-8H2 |
| InChIKey | UIPVAYWWNLBBBL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|