C17H23N3O2 — CID 141063419
2-[2-(cyclohexen-1-yl)ethyl]-3-(6-methoxy-3-pyridinyl)-3H-1,2-oxazol-5-amine (PubChem CID 141063419) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-3-(6-methoxy-3-pyridinyl)-3H-1,2-oxazol-5-amine.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-3-(6-methoxy-3-pyridinyl)-3H-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 141063419 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-3-(6-methoxy-3-pyridinyl)-3H-1,2-oxazol-5-amine |
| SMILES | COc1ccc(C2C=C(N)ON2CCC2=CCCCC2)cn1 |
| InChI | InChI=1S/C17H23N3O2/c1-21-17-8-7-14(12-19-17)15-11-16(18)22-20(15)10-9-13-5-3-2-4-6-13/h5,7-8,11-12,15H,2-4,6,9-10,18H2,1H3 |
| InChIKey | IRSZDDPLACBRLN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|