C17H21F2N3O2 — CID 141064912
6-(3,4-difluorophenyl)-4-[(2-hydroxyethylamino)methyl]-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 141064912) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-4-[(2-hydroxyethylamino)methyl]-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 6-(3,4-difluorophenyl)-4-[(2-hydroxyethylamino)methyl]-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 141064912 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-(3,4-difluorophenyl)-4-[(2-hydroxyethylamino)methyl]-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | CC(C)Cn1nc(-c2ccc(F)c(F)c2)cc(CNCCO)c1=O |
| InChI | InChI=1S/C17H21F2N3O2/c1-11(2)10-22-17(24)13(9-20-5-6-23)8-16(21-22)12-3-4-14(18)15(19)7-12/h3-4,7-8,11,20,23H,5-6,9-10H2,1-2H3 |
| InChIKey | UKKBIRFBDABKJV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|