About 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone
1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 141065535) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 141065535 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)N1CCOCC1 |
| InChI | InChI=1S/C9H12N2O2S/c12-9(5-8-6-10-7-14-8)11-1-3-13-4-2-11/h6-7H,1-5H2 |
| InChIKey | CSDNSCXXCAKAKM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone (CID 141065535) is 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone is O=C(Cc1cncs1)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone?
The InChIKey is CSDNSCXXCAKAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c12-9(5-8-6-10-7-14-8)11-1-3-13-4-2-11/h6-7H,1-5H2.
What are the key properties of 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone?
1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone has a molecular weight of 212.27 g/mol, XLogP of 0.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-2-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 141065535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).