C16H16O4 — CID 141065786
3-(1,3,3a,4,5,5a-hexahydrobenzo[e][2]benzofuran-5-yl)oxolane-2,5-dione (PubChem CID 141065786) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-(1,3,3a,4,5,5a-hexahydrobenzo[e][2]benzofuran-5-yl)oxolane-2,5-dione.
| Compound Name | 3-(1,3,3a,4,5,5a-hexahydrobenzo[e][2]benzofuran-5-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 141065786 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-(1,3,3a,4,5,5a-hexahydrobenzo[e][2]benzofuran-5-yl)oxolane-2,5-dione |
| SMILES | O=C1CC(C2CC3COCC3=C3C=CC=CC32)C(=O)O1 |
| InChI | InChI=1S/C16H16O4/c17-15-6-13(16(18)20-15)12-5-9-7-19-8-14(9)11-4-2-1-3-10(11)12/h1-4,9-10,12-13H,5-8H2 |
| InChIKey | DTQYKUXPZHPXMO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|