C24H20O3S — CID 141066182
3-[(4-methylphenyl)sulfanylmethyl]-4-oxo-4-(4-phenylphenyl)but-2-enoic acid (PubChem CID 141066182) has the molecular formula C24H20O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfanylmethyl]-4-oxo-4-(4-phenylphenyl)but-2-enoic acid.
| Compound Name | 3-[(4-methylphenyl)sulfanylmethyl]-4-oxo-4-(4-phenylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 141066182 |
| Molecular Formula | C24H20O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[(4-methylphenyl)sulfanylmethyl]-4-oxo-4-(4-phenylphenyl)but-2-enoic acid |
| SMILES | Cc1ccc(SCC(=CC(=O)O)C(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H20O3S/c1-17-7-13-22(14-8-17)28-16-21(15-23(25)26)24(27)20-11-9-19(10-12-20)18-5-3-2-4-6-18/h2-15H,16H2,1H3,(H,25,26) |
| InChIKey | JPGOEGARFCGTKZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|