C18H19NO4S — CID 141066195
N-hydroxy-2-(2-hydroxyethylsulfanyl)-4-oxo-4-(4-phenylphenyl)butanamide (PubChem CID 141066195) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-hydroxy-2-(2-hydroxyethylsulfanyl)-4-oxo-4-(4-phenylphenyl)butanamide.
| Compound Name | N-hydroxy-2-(2-hydroxyethylsulfanyl)-4-oxo-4-(4-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 141066195 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-hydroxy-2-(2-hydroxyethylsulfanyl)-4-oxo-4-(4-phenylphenyl)butanamide |
| SMILES | O=C(CC(SCCO)C(=O)NO)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c20-10-11-24-17(18(22)19-23)12-16(21)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,17,20,23H,10-12H2,(H,19,22) |
| InChIKey | YBXGTKIJHHQBKT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|