C16H17NOS — CID 141066668
8-methoxy-N,N-dimethyl-9H-thioxanthen-3-amine (PubChem CID 141066668) has the molecular formula C16H17NOS and a molecular weight of 271.39 g/mol. Its IUPAC name is 8-methoxy-N,N-dimethyl-9H-thioxanthen-3-amine.
| Compound Name | 8-methoxy-N,N-dimethyl-9H-thioxanthen-3-amine |
|---|---|
| PubChem CID | 141066668 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 8-methoxy-N,N-dimethyl-9H-thioxanthen-3-amine |
| SMILES | COc1cccc2c1Cc1ccc(N(C)C)cc1S2 |
| InChI | InChI=1S/C16H17NOS/c1-17(2)12-8-7-11-9-13-14(18-3)5-4-6-15(13)19-16(11)10-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | CAWICRUYFBRBIO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |