About triazolo[4,5-c]pyridin-7-one
triazolo[4,5-c]pyridin-7-one (PubChem CID 141066869) has the molecular formula C5H2N4O
and a molecular weight of 134.10 g/mol. Its IUPAC name is triazolo[4,5-c]pyridin-7-one.
Molecular Properties
| Compound Name | triazolo[4,5-c]pyridin-7-one |
| PubChem CID | 141066869 |
| Molecular Formula | C5H2N4O |
| Molecular Weight | 134.10 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | triazolo[4,5-c]pyridin-7-one |
| SMILES | O=C1C=NC=C2N=NN=C12 |
| InChI | InChI=1S/C5H2N4O/c10-4-2-6-1-3-5(4)8-9-7-3/h1-2H |
| InChIKey | UJMNHPFCIFIMLX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.10 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze triazolo[4,5-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-c]pyridin-7-one?
The IUPAC name of triazolo[4,5-c]pyridin-7-one (CID 141066869) is triazolo[4,5-c]pyridin-7-one.
What is the SMILES notation for triazolo[4,5-c]pyridin-7-one?
The canonical SMILES for triazolo[4,5-c]pyridin-7-one is O=C1C=NC=C2N=NN=C12.
What is the InChIKey of triazolo[4,5-c]pyridin-7-one?
The InChIKey is UJMNHPFCIFIMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N4O/c10-4-2-6-1-3-5(4)8-9-7-3/h1-2H.
What are the key properties of triazolo[4,5-c]pyridin-7-one?
triazolo[4,5-c]pyridin-7-one has a molecular weight of 134.10 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-c]pyridin-7-one is sourced from PubChem (CID 141066869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).