C18H10F5IO3S — CID 141066923
(diphenyl-λ3-iodanyl) 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 141066923) has the molecular formula C18H10F5IO3S and a molecular weight of 528.24 g/mol. Its IUPAC name is (diphenyl-λ3-iodanyl) 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (diphenyl-λ3-iodanyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 141066923 |
| Molecular Formula | C18H10F5IO3S |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | (diphenyl-λ3-iodanyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)(OI(c1ccccc1)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H10F5IO3S/c19-13-14(20)16(22)18(17(23)15(13)21)28(25,26)27-24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YAXOLWHDLNOOQV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|