C20H20O — CID 141067355
2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)naphthalene-1-carbaldehyde (PubChem CID 141067355) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)naphthalene-1-carbaldehyde.
| Compound Name | 2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 141067355 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)naphthalene-1-carbaldehyde |
| SMILES | CC1=C(C)C(c2ccc3ccccc3c2C=O)C(C)=C1C |
| InChI | InChI=1S/C20H20O/c1-12-13(2)15(4)20(14(12)3)18-10-9-16-7-5-6-8-17(16)19(18)11-21/h5-11,20H,1-4H3 |
| InChIKey | UCYWNEHPAGMZSD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|