About [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine
[3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine (PubChem CID 141067416) has the molecular formula C23H19N
and a molecular weight of 309.41 g/mol. Its IUPAC name is [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine.
Molecular Properties
| Compound Name | [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine |
| PubChem CID | 141067416 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine |
| SMILES | [H]/N=C(\c1ccccc1)c1cc2ccccc2cc1C1C=CC(C)=C1 |
| InChI | InChI=1S/C23H19N/c1-16-11-12-20(13-16)21-14-18-9-5-6-10-19(18)15-22(21)23(24)17-7-3-2-4-8-17/h2-15,20,24H,1H3/b24-23+ |
| InChIKey | ZSGQVQQSRWJZPZ-WCWDXBQESA-N |
| XLogP | 5.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine?
The IUPAC name of [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine (CID 141067416) is [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine.
What is the SMILES notation for [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine?
The canonical SMILES for [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine is [H]/N=C(\c1ccccc1)c1cc2ccccc2cc1C1C=CC(C)=C1.
What is the InChIKey of [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine?
The InChIKey is ZSGQVQQSRWJZPZ-WCWDXBQESA-N. The full InChI is InChI=1S/C23H19N/c1-16-11-12-20(13-16)21-14-18-9-5-6-10-19(18)15-22(21)23(24)17-7-3-2-4-8-17/h2-15,20,24H,1H3/b24-23+.
What are the key properties of [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine?
[3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine has a molecular weight of 309.41 g/mol, XLogP of 5.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-methylcyclopenta-2,4-dien-1-yl)naphthalen-2-yl]-phenylmethanimine is sourced from PubChem (CID 141067416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).