C31H17F6N3O6 — CID 141068095
2,3-bis[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]pyridine (PubChem CID 141068095) has the molecular formula C31H17F6N3O6 and a molecular weight of 641.48 g/mol. Its IUPAC name is 2,3-bis[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]pyridine.
| Compound Name | 2,3-bis[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]pyridine |
|---|---|
| PubChem CID | 141068095 |
| Molecular Formula | C31H17F6N3O6 |
| Molecular Weight | 641.48 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | 2,3-bis[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(-c3cccnc3-c3ccc(Oc4ccc([N+](=O)[O-])cc4C(F)(F)F)cc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H17F6N3O6/c32-30(33,34)25-16-20(39(41)42)7-13-27(25)45-22-9-3-18(4-10-22)24-2-1-15-38-29(24)19-5-11-23(12-6-19)46-28-14-8-21(40(43)44)17-26(28)31(35,36)37/h1-17H |
| InChIKey | WXHBNNVSWZVGQC-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 117.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.48 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|