C10H16O — CID 14106817
(3R,4S)-3-ethenyl-3-methyl-4-prop-1-en-2-yloxolane (PubChem CID 14106817) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3R,4S)-3-ethenyl-3-methyl-4-prop-1-en-2-yloxolane.
| Compound Name | (3R,4S)-3-ethenyl-3-methyl-4-prop-1-en-2-yloxolane |
|---|---|
| PubChem CID | 14106817 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3R,4S)-3-ethenyl-3-methyl-4-prop-1-en-2-yloxolane |
| SMILES | C=C[C@@]1(C)COC[C@H]1C(=C)C |
| InChI | InChI=1S/C10H16O/c1-5-10(4)7-11-6-9(10)8(2)3/h5,9H,1-2,6-7H2,3-4H3/t9-,10-/m0/s1 |
| InChIKey | KPCIWUMOJOIFNN-UWVGGRQHSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|