About 3,5-diaminobenzene-1,2-diol;hydrochloride
3,5-diaminobenzene-1,2-diol;hydrochloride (PubChem CID 141068565) has the molecular formula C6H9ClN2O2
and a molecular weight of 176.60 g/mol. Its IUPAC name is 3,5-diaminobenzene-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | 3,5-diaminobenzene-1,2-diol;hydrochloride |
| PubChem CID | 141068565 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 3,5-diaminobenzene-1,2-diol;hydrochloride |
| SMILES | Cl.Nc1cc(N)c(O)c(O)c1 |
| InChI | InChI=1S/C6H8N2O2.ClH/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,9-10H,7-8H2;1H |
| InChIKey | LXCCNTJMWKUABW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diaminobenzene-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diaminobenzene-1,2-diol;hydrochloride?
The IUPAC name of 3,5-diaminobenzene-1,2-diol;hydrochloride (CID 141068565) is 3,5-diaminobenzene-1,2-diol;hydrochloride.
What is the SMILES notation for 3,5-diaminobenzene-1,2-diol;hydrochloride?
The canonical SMILES for 3,5-diaminobenzene-1,2-diol;hydrochloride is Cl.Nc1cc(N)c(O)c(O)c1.
What is the InChIKey of 3,5-diaminobenzene-1,2-diol;hydrochloride?
The InChIKey is LXCCNTJMWKUABW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.ClH/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,9-10H,7-8H2;1H.
What are the key properties of 3,5-diaminobenzene-1,2-diol;hydrochloride?
3,5-diaminobenzene-1,2-diol;hydrochloride has a molecular weight of 176.60 g/mol, XLogP of 0.68, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diaminobenzene-1,2-diol;hydrochloride is sourced from PubChem (CID 141068565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).