C14H13N5O — CID 141068601
4-methoxy-6-(4-methylphenyl)pteridin-2-amine (PubChem CID 141068601) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-methoxy-6-(4-methylphenyl)pteridin-2-amine.
| Compound Name | 4-methoxy-6-(4-methylphenyl)pteridin-2-amine |
|---|---|
| PubChem CID | 141068601 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-methoxy-6-(4-methylphenyl)pteridin-2-amine |
| SMILES | COc1nc(N)nc2ncc(-c3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C14H13N5O/c1-8-3-5-9(6-4-8)10-7-16-12-11(17-10)13(20-2)19-14(15)18-12/h3-7H,1-2H3,(H2,15,16,18,19) |
| InChIKey | CTDLQOCOVAXXQE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |