C16H18FNO — CID 141069181
4-[2-(3-fluorophenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 141069181) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | 4-[2-(3-fluorophenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 141069181 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[2-(3-fluorophenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | OC1(C#Cc2cccc(F)c2)CCCC2CNCC21 |
| InChI | InChI=1S/C16H18FNO/c17-14-5-1-3-12(9-14)6-8-16(19)7-2-4-13-10-18-11-15(13)16/h1,3,5,9,13,15,18-19H,2,4,7,10-11H2 |
| InChIKey | ZXURYIPPTNBBEA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|