C28H6F10N2O11S2 — CID 141069201
[4-[1,3-dioxo-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyisoindol-4-yl]oxy-1,3-dioxoisoindol-2-yl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 141069201) has the molecular formula C28H6F10N2O11S2 and a molecular weight of 800.47 g/mol. Its IUPAC name is [4-[1,3-dioxo-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyisoindol-4-yl]oxy-1,3-dioxoisoindol-2-yl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [4-[1,3-dioxo-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyisoindol-4-yl]oxy-1,3-dioxoisoindol-2-yl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 141069201 |
| Molecular Formula | C28H6F10N2O11S2 |
| Molecular Weight | 800.47 g/mol |
| Exact Mass | 799.93 |
| IUPAC Name | [4-[1,3-dioxo-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyisoindol-4-yl]oxy-1,3-dioxoisoindol-2-yl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=C1c2cccc(Oc3cccc4c3C(=O)N(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)C4=O)c2C(=O)N1OS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H6F10N2O11S2/c29-13-15(31)19(35)23(20(36)16(13)32)52(45,46)50-39-25(41)7-3-1-5-9(11(7)27(39)43)49-10-6-2-4-8-12(10)28(44)40(26(8)42)51-53(47,48)24-21(37)17(33)14(30)18(34)22(24)38/h1-6H |
| InChIKey | LJVUUZSLFRIQDR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 170.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|