About 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride
10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride (PubChem CID 141069412) has the molecular formula C16H19Cl3N2O2S
and a molecular weight of 409.77 g/mol. Its IUPAC name is 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride.
Molecular Properties
| Compound Name | 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride |
| PubChem CID | 141069412 |
| Molecular Formula | C16H19Cl3N2O2S |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCCC(=O)Oc1cccc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C16H16N2O2S.3ClH/c17-10-4-9-15(19)20-12-6-3-8-14-16(12)18-11-5-1-2-7-13(11)21-14;;;/h1-3,5-8,18H,4,9-10,17H2;3*1H |
| InChIKey | FBLVVGOCOSOREN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride?
The IUPAC name of 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride (CID 141069412) is 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride.
What is the SMILES notation for 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride?
The canonical SMILES for 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride is Cl.Cl.Cl.NCCCC(=O)Oc1cccc2c1Nc1ccccc1S2.
What is the InChIKey of 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride?
The InChIKey is FBLVVGOCOSOREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S.3ClH/c17-10-4-9-15(19)20-12-6-3-8-14-16(12)18-11-5-1-2-7-13(11)21-14;;;/h1-3,5-8,18H,4,9-10,17H2;3*1H.
What are the key properties of 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride?
10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride has a molecular weight of 409.77 g/mol, XLogP of 4.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenothiazin-1-yl 4-aminobutanoate;trihydrochloride is sourced from PubChem (CID 141069412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).