C29H30FN5 — CID 141069487
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-[4-(2H-isoindol-1-yl)butyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 141069487) has the molecular formula C29H30FN5 and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-[4-(2H-isoindol-1-yl)butyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-[4-(2H-isoindol-1-yl)butyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 141069487 |
| Molecular Formula | C29H30FN5 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-[4-(2H-isoindol-1-yl)butyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | Fc1ccc2nc(CN(CCCCc3[nH]cc4ccccc34)C3CCCc4cccnc43)[nH]c2c1 |
| InChI | InChI=1S/C29H30FN5/c30-22-13-14-25-26(17-22)34-28(33-25)19-35(27-12-5-8-20-9-6-15-31-29(20)27)16-4-3-11-24-23-10-2-1-7-21(23)18-32-24/h1-2,6-7,9-10,13-15,17-18,27,32H,3-5,8,11-12,16,19H2,(H,33,34) |
| InChIKey | PRHUDONXVNFGEU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|